C36H28N6O7 — CID 177388501
1-N,3-N-bis[(E)-(2-hydroxyphenyl)methylideneamino]-5-[4-[[(E)-(2-hydroxyphenyl)methylideneamino]carbamoyl]phenoxy]benzene-1,3-dicarboxamide (PubChem CID 177388501) has the molecular formula C36H28N6O7 and a molecular weight of 656.66 g/mol. Its IUPAC name is 1-N,3-N-bis[(E)-(2-hydroxyphenyl)methylideneamino]-5-[4-[[(E)-(2-hydroxyphenyl)methylideneamino]carbamoyl]phenoxy]benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[(E)-(2-hydroxyphenyl)methylideneamino]-5-[4-[[(E)-(2-hydroxyphenyl)methylideneamino]carbamoyl]phenoxy]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 177388501 |
| Molecular Formula | C36H28N6O7 |
| Molecular Weight | 656.66 g/mol |
| Exact Mass | 656.20 |
| IUPAC Name | 1-N,3-N-bis[(E)-(2-hydroxyphenyl)methylideneamino]-5-[4-[[(E)-(2-hydroxyphenyl)methylideneamino]carbamoyl]phenoxy]benzene-1,3-dicarboxamide |
| SMILES | O=C(N/N=C/c1ccccc1O)c1ccc(Oc2cc(C(=O)N/N=C/c3ccccc3O)cc(C(=O)N/N=C/c3ccccc3O)c2)cc1 |
| InChI | InChI=1S/C36H28N6O7/c43-31-10-4-1-7-24(31)20-37-40-34(46)23-13-15-29(16-14-23)49-30-18-27(35(47)41-38-21-25-8-2-5-11-32(25)44)17-28(19-30)36(48)42-39-22-26-9-3-6-12-33(26)45/h1-22,43-45H,(H,40,46)(H,41,47)(H,42,48)/b37-20+,38-21+,39-22+ |
| InChIKey | PTWODRCJHCYYLH-IIDLNTKJSA-N |
| XLogP | 4.89 |
| TPSA | 194.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.66 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|