C16H18N3O2+ — CID 146938303
[4-[[(2-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]-dimethylazanium (PubChem CID 146938303) has the molecular formula C16H18N3O2+ and a molecular weight of 284.34 g/mol. Its IUPAC name is [4-[[(2-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]-dimethylazanium.
| Compound Name | [4-[[(2-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]-dimethylazanium |
|---|---|
| PubChem CID | 146938303 |
| Molecular Formula | C16H18N3O2+ |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | [4-[[(2-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]-dimethylazanium |
| SMILES | C[NH+](C)c1ccc(C(=O)NN=Cc2ccccc2O)cc1 |
| InChI | InChI=1S/C16H17N3O2/c1-19(2)14-9-7-12(8-10-14)16(21)18-17-11-13-5-3-4-6-15(13)20/h3-11,20H,1-2H3,(H,18,21)/p+1 |
| InChIKey | AGIZWGHZSYMWEP-UHFFFAOYSA-O |
| XLogP | 0.93 |
| TPSA | 66.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|