C10H15N3OS2 — CID 6383625
1-(2-methoxyethyl)-3-[(Z)-(5-methylthiophen-2-yl)methylideneamino]thiourea (PubChem CID 6383625) has the molecular formula C10H15N3OS2 and a molecular weight of 257.38 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-[(Z)-(5-methylthiophen-2-yl)methylideneamino]thiourea.
| Compound Name | 1-(2-methoxyethyl)-3-[(Z)-(5-methylthiophen-2-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 6383625 |
| Molecular Formula | C10H15N3OS2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 1-(2-methoxyethyl)-3-[(Z)-(5-methylthiophen-2-yl)methylideneamino]thiourea |
| SMILES | COCCNC(=S)N/N=C\c1ccc(C)s1 |
| InChI | InChI=1S/C10H15N3OS2/c1-8-3-4-9(16-8)7-12-13-10(15)11-5-6-14-2/h3-4,7H,5-6H2,1-2H3,(H2,11,13,15)/b12-7- |
| InChIKey | ZDMGMGCOUKAOOT-GHXNOFRVSA-N |
| XLogP | 1.50 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|