C26H22Cl2N2O3 — CID 126010307
methyl (5Z)-5-[[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-4-oxo-1-phenylpyrrole-3-carboxylate (PubChem CID 126010307) has the molecular formula C26H22Cl2N2O3 and a molecular weight of 481.38 g/mol. Its IUPAC name is methyl (5Z)-5-[[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-4-oxo-1-phenylpyrrole-3-carboxylate.
| Compound Name | methyl (5Z)-5-[[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-4-oxo-1-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126010307 |
| Molecular Formula | C26H22Cl2N2O3 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | methyl (5Z)-5-[[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-4-oxo-1-phenylpyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccccc2)/C(=C\c2cc(C)n(-c3cc(Cl)cc(Cl)c3)c2C)C1=O |
| InChI | InChI=1S/C26H22Cl2N2O3/c1-15-10-18(16(2)29(15)22-13-19(27)12-20(28)14-22)11-23-25(31)24(26(32)33-4)17(3)30(23)21-8-6-5-7-9-21/h5-14H,1-4H3/b23-11- |
| InChIKey | UHZVIWPRIUPCTA-KSEXSDGBSA-N |
| XLogP | 6.28 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|