C26H21BrCl2N2O3 — CID 126006683
methyl (5Z)-1-(4-bromophenyl)-5-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-4-oxopyrrole-3-carboxylate (PubChem CID 126006683) has the molecular formula C26H21BrCl2N2O3 and a molecular weight of 560.28 g/mol. Its IUPAC name is methyl (5Z)-1-(4-bromophenyl)-5-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-4-oxopyrrole-3-carboxylate.
| Compound Name | methyl (5Z)-1-(4-bromophenyl)-5-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-4-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126006683 |
| Molecular Formula | C26H21BrCl2N2O3 |
| Molecular Weight | 560.28 g/mol |
| Exact Mass | 558.01 |
| IUPAC Name | methyl (5Z)-1-(4-bromophenyl)-5-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-4-oxopyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccc(Br)cc2)/C(=C\c2cc(C)n(-c3ccc(Cl)c(Cl)c3)c2C)C1=O |
| InChI | InChI=1S/C26H21BrCl2N2O3/c1-14-11-17(15(2)30(14)20-9-10-21(28)22(29)13-20)12-23-25(32)24(26(33)34-4)16(3)31(23)19-7-5-18(27)6-8-19/h5-13H,1-4H3/b23-12- |
| InChIKey | WYLLRAZXKONJEM-FMCGGJTJSA-N |
| XLogP | 7.04 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.28 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|