C27H21Cl2NO4 — CID 94833324
methyl (5Z)-1-(3,4-dichlorophenyl)-2-methyl-4-oxo-5-[(4-phenylmethoxyphenyl)methylidene]pyrrole-3-carboxylate (PubChem CID 94833324) has the molecular formula C27H21Cl2NO4 and a molecular weight of 494.37 g/mol. Its IUPAC name is methyl (5Z)-1-(3,4-dichlorophenyl)-2-methyl-4-oxo-5-[(4-phenylmethoxyphenyl)methylidene]pyrrole-3-carboxylate.
| Compound Name | methyl (5Z)-1-(3,4-dichlorophenyl)-2-methyl-4-oxo-5-[(4-phenylmethoxyphenyl)methylidene]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 94833324 |
| Molecular Formula | C27H21Cl2NO4 |
| Molecular Weight | 494.37 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | methyl (5Z)-1-(3,4-dichlorophenyl)-2-methyl-4-oxo-5-[(4-phenylmethoxyphenyl)methylidene]pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccc(Cl)c(Cl)c2)/C(=C\c2ccc(OCc3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C27H21Cl2NO4/c1-17-25(27(32)33-2)26(31)24(30(17)20-10-13-22(28)23(29)15-20)14-18-8-11-21(12-9-18)34-16-19-6-4-3-5-7-19/h3-15H,16H2,1-2H3/b24-14- |
| InChIKey | WSFAZHVWLGHRAY-OYKKKHCWSA-N |
| XLogP | 6.45 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.37 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|