C28H25NO4 — CID 94846959
methyl (5E)-2-methyl-1-(4-methylphenyl)-4-oxo-5-[(4-phenylmethoxyphenyl)methylidene]pyrrole-3-carboxylate (PubChem CID 94846959) has the molecular formula C28H25NO4 and a molecular weight of 439.51 g/mol. Its IUPAC name is methyl (5E)-2-methyl-1-(4-methylphenyl)-4-oxo-5-[(4-phenylmethoxyphenyl)methylidene]pyrrole-3-carboxylate.
| Compound Name | methyl (5E)-2-methyl-1-(4-methylphenyl)-4-oxo-5-[(4-phenylmethoxyphenyl)methylidene]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 94846959 |
| Molecular Formula | C28H25NO4 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | methyl (5E)-2-methyl-1-(4-methylphenyl)-4-oxo-5-[(4-phenylmethoxyphenyl)methylidene]pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccc(C)cc2)/C(=C/c2ccc(OCc3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C28H25NO4/c1-19-9-13-23(14-10-19)29-20(2)26(28(31)32-3)27(30)25(29)17-21-11-15-24(16-12-21)33-18-22-7-5-4-6-8-22/h4-17H,18H2,1-3H3/b25-17+ |
| InChIKey | DPFPZCVCEARJKA-KOEQRZSOSA-N |
| XLogP | 5.45 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|