C27H28N2O6 — CID 94833039
methyl (5Z)-2-methyl-4-oxo-5-[[4-[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylidene]-1-phenylpyrrole-3-carboxylate (PubChem CID 94833039) has the molecular formula C27H28N2O6 and a molecular weight of 476.53 g/mol. Its IUPAC name is methyl (5Z)-2-methyl-4-oxo-5-[[4-[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylidene]-1-phenylpyrrole-3-carboxylate.
| Compound Name | methyl (5Z)-2-methyl-4-oxo-5-[[4-[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylidene]-1-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 94833039 |
| Molecular Formula | C27H28N2O6 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | methyl (5Z)-2-methyl-4-oxo-5-[[4-[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylidene]-1-phenylpyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccccc2)/C(=C\c2ccc(OCC(=O)NC[C@H]3CCCO3)cc2)C1=O |
| InChI | InChI=1S/C27H28N2O6/c1-18-25(27(32)33-2)26(31)23(29(18)20-7-4-3-5-8-20)15-19-10-12-21(13-11-19)35-17-24(30)28-16-22-9-6-14-34-22/h3-5,7-8,10-13,15,22H,6,9,14,16-17H2,1-2H3,(H,28,30)/b23-15-/t22-/m1/s1 |
| InChIKey | DFLYRNGSKJOBMV-IQDKPADRSA-N |
| XLogP | 3.24 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|