C29H32N2O5 — CID 126007480
methyl (5Z)-5-[[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylidene]-2-methyl-1-(4-methylphenyl)-4-oxopyrrole-3-carboxylate (PubChem CID 126007480) has the molecular formula C29H32N2O5 and a molecular weight of 488.58 g/mol. Its IUPAC name is methyl (5Z)-5-[[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylidene]-2-methyl-1-(4-methylphenyl)-4-oxopyrrole-3-carboxylate.
| Compound Name | methyl (5Z)-5-[[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylidene]-2-methyl-1-(4-methylphenyl)-4-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126007480 |
| Molecular Formula | C29H32N2O5 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | methyl (5Z)-5-[[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylidene]-2-methyl-1-(4-methylphenyl)-4-oxopyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccc(C)cc2)/C(=C\c2ccc(OCC(=O)NC3CCCCC3)cc2)C1=O |
| InChI | InChI=1S/C29H32N2O5/c1-19-9-13-23(14-10-19)31-20(2)27(29(34)35-3)28(33)25(31)17-21-11-15-24(16-12-21)36-18-26(32)30-22-7-5-4-6-8-22/h9-17,22H,4-8,18H2,1-3H3,(H,30,32)/b25-17- |
| InChIKey | NMDMYRORNPRYNU-UQQQWYQISA-N |
| XLogP | 4.70 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|