C30H34N2O5 — CID 98087670
methyl (5Z)-5-[[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylidene]-1-(3,5-dimethylphenyl)-2-methyl-4-oxopyrrole-3-carboxylate (PubChem CID 98087670) has the molecular formula C30H34N2O5 and a molecular weight of 502.61 g/mol. Its IUPAC name is methyl (5Z)-5-[[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylidene]-1-(3,5-dimethylphenyl)-2-methyl-4-oxopyrrole-3-carboxylate.
| Compound Name | methyl (5Z)-5-[[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylidene]-1-(3,5-dimethylphenyl)-2-methyl-4-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 98087670 |
| Molecular Formula | C30H34N2O5 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | methyl (5Z)-5-[[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylidene]-1-(3,5-dimethylphenyl)-2-methyl-4-oxopyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2cc(C)cc(C)c2)/C(=C\c2ccc(OCC(=O)NC3CCCCC3)cc2)C1=O |
| InChI | InChI=1S/C30H34N2O5/c1-19-14-20(2)16-24(15-19)32-21(3)28(30(35)36-4)29(34)26(32)17-22-10-12-25(13-11-22)37-18-27(33)31-23-8-6-5-7-9-23/h10-17,23H,5-9,18H2,1-4H3,(H,31,33)/b26-17- |
| InChIKey | SSXKLVWJXBDPAC-ONUIUJJFSA-N |
| XLogP | 5.01 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|