C31H26N4O4 — CID 126013367
N-[(E)-[4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 126013367) has the molecular formula C31H26N4O4 and a molecular weight of 518.57 g/mol. Its IUPAC name is N-[(E)-[4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-[(E)-[4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 126013367 |
| Molecular Formula | C31H26N4O4 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | N-[(E)-[4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | Cc1ccccc1NC(=O)COc1ccc(/C=N/NC(=O)Cn2c3ccccc3c(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C31H26N4O4/c1-21-8-2-5-11-26(21)33-30(37)20-39-23-16-14-22(15-17-23)18-32-34-29(36)19-35-27-12-6-3-9-24(27)31(38)25-10-4-7-13-28(25)35/h2-18H,19-20H2,1H3,(H,33,37)(H,34,36)/b32-18+ |
| InChIKey | KVMOLYMGJGBLSI-KCSSXMTESA-N |
| XLogP | 4.63 |
| TPSA | 101.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|