C23H29N3O6S — CID 126014237
1-[2-[benzyl-(3,4-dimethoxyphenyl)sulfonylamino]acetyl]piperidine-4-carboxamide (PubChem CID 126014237) has the molecular formula C23H29N3O6S and a molecular weight of 475.57 g/mol. Its IUPAC name is 1-[2-[benzyl-(3,4-dimethoxyphenyl)sulfonylamino]acetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[benzyl-(3,4-dimethoxyphenyl)sulfonylamino]acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126014237 |
| Molecular Formula | C23H29N3O6S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 1-[2-[benzyl-(3,4-dimethoxyphenyl)sulfonylamino]acetyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)N2CCC(C(N)=O)CC2)Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C23H29N3O6S/c1-31-20-9-8-19(14-21(20)32-2)33(29,30)26(15-17-6-4-3-5-7-17)16-22(27)25-12-10-18(11-13-25)23(24)28/h3-9,14,18H,10-13,15-16H2,1-2H3,(H2,24,28) |
| InChIKey | YOFDNYNGXAWRLL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |