C17H11BrCl2N2 — CID 126015515
1-[1-(3-bromophenyl)pyrrol-2-yl]-N-(2,3-dichlorophenyl)methanimine (PubChem CID 126015515) has the molecular formula C17H11BrCl2N2 and a molecular weight of 394.10 g/mol. Its IUPAC name is 1-[1-(3-bromophenyl)pyrrol-2-yl]-N-(2,3-dichlorophenyl)methanimine.
| Compound Name | 1-[1-(3-bromophenyl)pyrrol-2-yl]-N-(2,3-dichlorophenyl)methanimine |
|---|---|
| PubChem CID | 126015515 |
| Molecular Formula | C17H11BrCl2N2 |
| Molecular Weight | 394.10 g/mol |
| Exact Mass | 391.95 |
| IUPAC Name | 1-[1-(3-bromophenyl)pyrrol-2-yl]-N-(2,3-dichlorophenyl)methanimine |
| SMILES | Clc1cccc(/N=C/c2cccn2-c2cccc(Br)c2)c1Cl |
| InChI | InChI=1S/C17H11BrCl2N2/c18-12-4-1-5-13(10-12)22-9-3-6-14(22)11-21-16-8-2-7-15(19)17(16)20/h1-11H/b21-11+ |
| InChIKey | AIFGKLTWKLALGK-SRZZPIQSSA-N |
| XLogP | 6.30 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.10 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|