C18H12BrCl2N3O — CID 126025346
N-[(Z)-[1-(3-bromophenyl)pyrrol-2-yl]methylideneamino]-3,4-dichlorobenzamide (PubChem CID 126025346) has the molecular formula C18H12BrCl2N3O and a molecular weight of 437.12 g/mol. Its IUPAC name is N-[(Z)-[1-(3-bromophenyl)pyrrol-2-yl]methylideneamino]-3,4-dichlorobenzamide.
| Compound Name | N-[(Z)-[1-(3-bromophenyl)pyrrol-2-yl]methylideneamino]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 126025346 |
| Molecular Formula | C18H12BrCl2N3O |
| Molecular Weight | 437.12 g/mol |
| Exact Mass | 434.95 |
| IUPAC Name | N-[(Z)-[1-(3-bromophenyl)pyrrol-2-yl]methylideneamino]-3,4-dichlorobenzamide |
| SMILES | O=C(N/N=C\c1cccn1-c1cccc(Br)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H12BrCl2N3O/c19-13-3-1-4-14(10-13)24-8-2-5-15(24)11-22-23-18(25)12-6-7-16(20)17(21)9-12/h1-11H,(H,23,25)/b22-11- |
| InChIKey | ZAWLOQDKOJNBBW-JJFYIABZSA-N |
| XLogP | 5.31 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.12 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|