C20H19BrN4O — CID 126027034
N-[(Z)-[1-(3-bromophenyl)pyrrol-2-yl]methylideneamino]-3-(dimethylamino)benzamide (PubChem CID 126027034) has the molecular formula C20H19BrN4O and a molecular weight of 411.30 g/mol. Its IUPAC name is N-[(Z)-[1-(3-bromophenyl)pyrrol-2-yl]methylideneamino]-3-(dimethylamino)benzamide.
| Compound Name | N-[(Z)-[1-(3-bromophenyl)pyrrol-2-yl]methylideneamino]-3-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 126027034 |
| Molecular Formula | C20H19BrN4O |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | N-[(Z)-[1-(3-bromophenyl)pyrrol-2-yl]methylideneamino]-3-(dimethylamino)benzamide |
| SMILES | CN(C)c1cccc(C(=O)N/N=C\c2cccn2-c2cccc(Br)c2)c1 |
| InChI | InChI=1S/C20H19BrN4O/c1-24(2)17-8-3-6-15(12-17)20(26)23-22-14-19-10-5-11-25(19)18-9-4-7-16(21)13-18/h3-14H,1-2H3,(H,23,26)/b22-14- |
| InChIKey | PMTOMQVNYIBATD-HMAPJEAMSA-N |
| XLogP | 4.07 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|