C26H24N4O2 — CID 126017935
N-(3,4-dimethylphenyl)-2-[3-[(Z)-(quinolin-2-ylhydrazinylidene)methyl]phenoxy]acetamide (PubChem CID 126017935) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[3-[(Z)-(quinolin-2-ylhydrazinylidene)methyl]phenoxy]acetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[3-[(Z)-(quinolin-2-ylhydrazinylidene)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126017935 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[3-[(Z)-(quinolin-2-ylhydrazinylidene)methyl]phenoxy]acetamide |
| SMILES | Cc1ccc(NC(=O)COc2cccc(/C=N\Nc3ccc4ccccc4n3)c2)cc1C |
| InChI | InChI=1S/C26H24N4O2/c1-18-10-12-22(14-19(18)2)28-26(31)17-32-23-8-5-6-20(15-23)16-27-30-25-13-11-21-7-3-4-9-24(21)29-25/h3-16H,17H2,1-2H3,(H,28,31)(H,29,30)/b27-16- |
| InChIKey | HGWDVMXCXGVCKG-YUMHPJSZSA-N |
| XLogP | 5.32 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|