C17H16N2O5S — CID 126018069
ethyl (2R)-2-[(5E)-5-[[2-(cyanomethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate (PubChem CID 126018069) has the molecular formula C17H16N2O5S and a molecular weight of 360.39 g/mol. Its IUPAC name is ethyl (2R)-2-[(5E)-5-[[2-(cyanomethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | ethyl (2R)-2-[(5E)-5-[[2-(cyanomethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 126018069 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | ethyl (2R)-2-[(5E)-5-[[2-(cyanomethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
| SMILES | CCOC(=O)[C@@H](C)N1C(=O)S/C(=C/c2ccccc2OCC#N)C1=O |
| InChI | InChI=1S/C17H16N2O5S/c1-3-23-16(21)11(2)19-15(20)14(25-17(19)22)10-12-6-4-5-7-13(12)24-9-8-18/h4-7,10-11H,3,9H2,1-2H3/b14-10+/t11-/m1/s1 |
| InChIKey | NLKXWRSNWLXBSC-ZTMOJVSCSA-N |
| XLogP | 2.58 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|