C24H26N2O6S — CID 126018597
(2S)-2-[4-[(Z)-[2-(4-ethoxyphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]propanoic acid (PubChem CID 126018597) has the molecular formula C24H26N2O6S and a molecular weight of 470.55 g/mol. Its IUPAC name is (2S)-2-[4-[(Z)-[2-(4-ethoxyphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]propanoic acid.
| Compound Name | (2S)-2-[4-[(Z)-[2-(4-ethoxyphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 126018597 |
| Molecular Formula | C24H26N2O6S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | (2S)-2-[4-[(Z)-[2-(4-ethoxyphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]propanoic acid |
| SMILES | CCOc1ccc(/N=C2/S/C(=C\c3ccc(O[C@@H](C)C(=O)O)c(OC)c3)C(=O)N2CC)cc1 |
| InChI | InChI=1S/C24H26N2O6S/c1-5-26-22(27)21(33-24(26)25-17-8-10-18(11-9-17)31-6-2)14-16-7-12-19(20(13-16)30-4)32-15(3)23(28)29/h7-15H,5-6H2,1-4H3,(H,28,29)/b21-14-,25-24+/t15-/m0/s1 |
| InChIKey | IJHSCVCXWOQRQR-CFYCDOGISA-N |
| XLogP | 4.57 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|