C18H12BrClN2O3S — CID 126019830
(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2-(4-bromo-3-chlorophenyl)imino-3-methyl-1,3-thiazolidin-4-one (PubChem CID 126019830) has the molecular formula C18H12BrClN2O3S and a molecular weight of 451.73 g/mol. Its IUPAC name is (5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2-(4-bromo-3-chlorophenyl)imino-3-methyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2-(4-bromo-3-chlorophenyl)imino-3-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126019830 |
| Molecular Formula | C18H12BrClN2O3S |
| Molecular Weight | 451.73 g/mol |
| Exact Mass | 449.94 |
| IUPAC Name | (5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2-(4-bromo-3-chlorophenyl)imino-3-methyl-1,3-thiazolidin-4-one |
| SMILES | CN1C(=O)/C(=C/c2ccc3c(c2)OCO3)S/C1=N/c1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C18H12BrClN2O3S/c1-22-17(23)16(7-10-2-5-14-15(6-10)25-9-24-14)26-18(22)21-11-3-4-12(19)13(20)8-11/h2-8H,9H2,1H3/b16-7-,21-18+ |
| InChIKey | MRWYLWFCEKHJRP-PPIPWTRGSA-N |
| XLogP | 5.07 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.73 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|