C21H14ClN3S2 — CID 126024191
(Z)-3-[5-(4-chlorophenyl)sulfanylthiophen-2-yl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile (PubChem CID 126024191) has the molecular formula C21H14ClN3S2 and a molecular weight of 407.95 g/mol. Its IUPAC name is (Z)-3-[5-(4-chlorophenyl)sulfanylthiophen-2-yl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-[5-(4-chlorophenyl)sulfanylthiophen-2-yl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126024191 |
| Molecular Formula | C21H14ClN3S2 |
| Molecular Weight | 407.95 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | (Z)-3-[5-(4-chlorophenyl)sulfanylthiophen-2-yl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1ccc2nc(/C(C#N)=C\c3ccc(Sc4ccc(Cl)cc4)s3)[nH]c2c1 |
| InChI | InChI=1S/C21H14ClN3S2/c1-13-2-8-18-19(10-13)25-21(24-18)14(12-23)11-17-7-9-20(27-17)26-16-5-3-15(22)4-6-16/h2-11H,1H3,(H,24,25)/b14-11- |
| InChIKey | MUMFFKXSNIYJJN-KAMYIIQDSA-N |
| XLogP | 6.80 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.95 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|