C27H33N3O4S — CID 126024587
(5Z)-5-[(3-methoxy-2-propan-2-yloxyphenyl)methylidene]-3-(3-morpholin-4-ylpropyl)-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 126024587) has the molecular formula C27H33N3O4S and a molecular weight of 495.65 g/mol. Its IUPAC name is (5Z)-5-[(3-methoxy-2-propan-2-yloxyphenyl)methylidene]-3-(3-morpholin-4-ylpropyl)-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3-methoxy-2-propan-2-yloxyphenyl)methylidene]-3-(3-morpholin-4-ylpropyl)-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126024587 |
| Molecular Formula | C27H33N3O4S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | (5Z)-5-[(3-methoxy-2-propan-2-yloxyphenyl)methylidene]-3-(3-morpholin-4-ylpropyl)-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | COc1cccc(/C=C2\S/C(=N/c3ccccc3)N(CCCN3CCOCC3)C2=O)c1OC(C)C |
| InChI | InChI=1S/C27H33N3O4S/c1-20(2)34-25-21(9-7-12-23(25)32-3)19-24-26(31)30(14-8-13-29-15-17-33-18-16-29)27(35-24)28-22-10-5-4-6-11-22/h4-7,9-12,19-20H,8,13-18H2,1-3H3/b24-19-,28-27+ |
| InChIKey | GZJQZJKJEACZEZ-DLYLFGHVSA-N |
| XLogP | 4.81 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|