C24H26BrN3O3S — CID 2367574
(5Z)-5-[(4-bromophenyl)methylidene]-2-(4-methoxyphenyl)imino-3-(3-morpholin-4-ylpropyl)-1,3-thiazolidin-4-one (PubChem CID 2367574) has the molecular formula C24H26BrN3O3S and a molecular weight of 516.46 g/mol. Its IUPAC name is (5Z)-5-[(4-bromophenyl)methylidene]-2-(4-methoxyphenyl)imino-3-(3-morpholin-4-ylpropyl)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(4-bromophenyl)methylidene]-2-(4-methoxyphenyl)imino-3-(3-morpholin-4-ylpropyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2367574 |
| Molecular Formula | C24H26BrN3O3S |
| Molecular Weight | 516.46 g/mol |
| Exact Mass | 515.09 |
| IUPAC Name | (5Z)-5-[(4-bromophenyl)methylidene]-2-(4-methoxyphenyl)imino-3-(3-morpholin-4-ylpropyl)-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/N=C2/S/C(=C\c3ccc(Br)cc3)C(=O)N2CCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C24H26BrN3O3S/c1-30-21-9-7-20(8-10-21)26-24-28(12-2-11-27-13-15-31-16-14-27)23(29)22(32-24)17-18-3-5-19(25)6-4-18/h3-10,17H,2,11-16H2,1H3/b22-17-,26-24+ |
| InChIKey | MZPSBWWZKLXFDP-JDQSIPCVSA-N |
| XLogP | 4.78 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|