C25H27F2N3O4S — CID 5221140
5-[[4-(difluoromethoxy)phenyl]methylidene]-3-(3-methoxypropyl)-2-(4-morpholin-4-ylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 5221140) has the molecular formula C25H27F2N3O4S and a molecular weight of 503.57 g/mol. Its IUPAC name is 5-[[4-(difluoromethoxy)phenyl]methylidene]-3-(3-methoxypropyl)-2-(4-morpholin-4-ylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[[4-(difluoromethoxy)phenyl]methylidene]-3-(3-methoxypropyl)-2-(4-morpholin-4-ylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5221140 |
| Molecular Formula | C25H27F2N3O4S |
| Molecular Weight | 503.57 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | 5-[[4-(difluoromethoxy)phenyl]methylidene]-3-(3-methoxypropyl)-2-(4-morpholin-4-ylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | COCCCN1C(=O)C(=Cc2ccc(OC(F)F)cc2)S/C1=N\c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C25H27F2N3O4S/c1-32-14-2-11-30-23(31)22(17-18-3-9-21(10-4-18)34-24(26)27)35-25(30)28-19-5-7-20(8-6-19)29-12-15-33-16-13-29/h3-10,17,24H,2,11-16H2,1H3/b22-17?,28-25- |
| InChIKey | YZRAXSOCZZQLQS-AJVXLDSSSA-N |
| XLogP | 4.77 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|