C26H31F2N3O3S — CID 5157494
5-[[4-(difluoromethoxy)phenyl]methylidene]-3-[2-[di(propan-2-yl)amino]ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 5157494) has the molecular formula C26H31F2N3O3S and a molecular weight of 503.62 g/mol. Its IUPAC name is 5-[[4-(difluoromethoxy)phenyl]methylidene]-3-[2-[di(propan-2-yl)amino]ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[[4-(difluoromethoxy)phenyl]methylidene]-3-[2-[di(propan-2-yl)amino]ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5157494 |
| Molecular Formula | C26H31F2N3O3S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 5-[[4-(difluoromethoxy)phenyl]methylidene]-3-[2-[di(propan-2-yl)amino]ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/N=C2\SC(=Cc3ccc(OC(F)F)cc3)C(=O)N2CCN(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C26H31F2N3O3S/c1-17(2)30(18(3)4)14-15-31-24(32)23(16-19-6-10-22(11-7-19)34-25(27)28)35-26(31)29-20-8-12-21(33-5)13-9-20/h6-13,16-18,25H,14-15H2,1-5H3/b23-16?,29-26- |
| InChIKey | IIUZKTGVMRYPSO-OIJJBCKLSA-N |
| XLogP | 6.02 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|