C23H23ClN2O2S — CID 84583204
(5Z)-5-[(4-chlorophenyl)methylidene]-2-(2,3-dihydro-1H-inden-5-ylimino)-3-(3-methoxypropyl)-1,3-thiazolidin-4-one (PubChem CID 84583204) has the molecular formula C23H23ClN2O2S and a molecular weight of 426.97 g/mol. Its IUPAC name is (5Z)-5-[(4-chlorophenyl)methylidene]-2-(2,3-dihydro-1H-inden-5-ylimino)-3-(3-methoxypropyl)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(4-chlorophenyl)methylidene]-2-(2,3-dihydro-1H-inden-5-ylimino)-3-(3-methoxypropyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 84583204 |
| Molecular Formula | C23H23ClN2O2S |
| Molecular Weight | 426.97 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | (5Z)-5-[(4-chlorophenyl)methylidene]-2-(2,3-dihydro-1H-inden-5-ylimino)-3-(3-methoxypropyl)-1,3-thiazolidin-4-one |
| SMILES | COCCCN1C(=O)/C(=C/c2ccc(Cl)cc2)S/C1=N/c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C23H23ClN2O2S/c1-28-13-3-12-26-22(27)21(14-16-6-9-19(24)10-7-16)29-23(26)25-20-11-8-17-4-2-5-18(17)15-20/h6-11,14-15H,2-5,12-13H2,1H3/b21-14-,25-23+ |
| InChIKey | RYMBHTOVCQXSJZ-SXZIKPQKSA-N |
| XLogP | 5.47 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.97 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|