C21H20ClFN2O3S — CID 2366940
(5Z)-2-(3-chloro-4-methoxyphenyl)imino-5-[(3-fluorophenyl)methylidene]-3-(3-methoxypropyl)-1,3-thiazolidin-4-one (PubChem CID 2366940) has the molecular formula C21H20ClFN2O3S and a molecular weight of 434.92 g/mol. Its IUPAC name is (5Z)-2-(3-chloro-4-methoxyphenyl)imino-5-[(3-fluorophenyl)methylidene]-3-(3-methoxypropyl)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(3-chloro-4-methoxyphenyl)imino-5-[(3-fluorophenyl)methylidene]-3-(3-methoxypropyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2366940 |
| Molecular Formula | C21H20ClFN2O3S |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | (5Z)-2-(3-chloro-4-methoxyphenyl)imino-5-[(3-fluorophenyl)methylidene]-3-(3-methoxypropyl)-1,3-thiazolidin-4-one |
| SMILES | COCCCN1C(=O)/C(=C/c2cccc(F)c2)S/C1=N/c1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C21H20ClFN2O3S/c1-27-10-4-9-25-20(26)19(12-14-5-3-6-15(23)11-14)29-21(25)24-16-7-8-18(28-2)17(22)13-16/h3,5-8,11-13H,4,9-10H2,1-2H3/b19-12-,24-21+ |
| InChIKey | DDVLEDHVUAGQDR-FAXOLUSMSA-N |
| XLogP | 5.13 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|