C21H20ClFN2O2S — CID 126015790
(5Z)-5-[[4-[(2S)-butan-2-yl]oxy-3-chlorophenyl]methylidene]-2-(3-fluorophenyl)imino-3-methyl-1,3-thiazolidin-4-one (PubChem CID 126015790) has the molecular formula C21H20ClFN2O2S and a molecular weight of 418.92 g/mol. Its IUPAC name is (5Z)-5-[[4-[(2S)-butan-2-yl]oxy-3-chlorophenyl]methylidene]-2-(3-fluorophenyl)imino-3-methyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-[(2S)-butan-2-yl]oxy-3-chlorophenyl]methylidene]-2-(3-fluorophenyl)imino-3-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126015790 |
| Molecular Formula | C21H20ClFN2O2S |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | (5Z)-5-[[4-[(2S)-butan-2-yl]oxy-3-chlorophenyl]methylidene]-2-(3-fluorophenyl)imino-3-methyl-1,3-thiazolidin-4-one |
| SMILES | CC[C@H](C)Oc1ccc(/C=C2\S/C(=N/c3cccc(F)c3)N(C)C2=O)cc1Cl |
| InChI | InChI=1S/C21H20ClFN2O2S/c1-4-13(2)27-18-9-8-14(10-17(18)22)11-19-20(26)25(3)21(28-19)24-16-7-5-6-15(23)12-16/h5-13H,4H2,1-3H3/b19-11-,24-21+/t13-/m0/s1 |
| InChIKey | ZFYNITSQRRJBAB-CMGZVLTJSA-N |
| XLogP | 5.89 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|