C22H21ClN2O4S — CID 126097991
methyl 2-[4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-3-propyl-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 126097991) has the molecular formula C22H21ClN2O4S and a molecular weight of 444.94 g/mol. Its IUPAC name is methyl 2-[4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-3-propyl-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-3-propyl-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126097991 |
| Molecular Formula | C22H21ClN2O4S |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | methyl 2-[4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-3-propyl-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | CCCN1C(=O)/C(=C/c2ccc(OCC(=O)OC)cc2)S/C1=N/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H21ClN2O4S/c1-3-12-25-21(27)19(30-22(25)24-17-8-6-16(23)7-9-17)13-15-4-10-18(11-5-15)29-14-20(26)28-2/h4-11,13H,3,12,14H2,1-2H3/b19-13-,24-22+ |
| InChIKey | QVIOEGPMVSTMIR-ZOVWXIRQSA-N |
| XLogP | 4.91 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|