C19H15F2N3O2S — CID 126024607
[4-[(Z)-[(4,5-dimethyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] 2,6-difluorobenzoate (PubChem CID 126024607) has the molecular formula C19H15F2N3O2S and a molecular weight of 387.41 g/mol. Its IUPAC name is [4-[(Z)-[(4,5-dimethyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] 2,6-difluorobenzoate.
| Compound Name | [4-[(Z)-[(4,5-dimethyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] 2,6-difluorobenzoate |
|---|---|
| PubChem CID | 126024607 |
| Molecular Formula | C19H15F2N3O2S |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | [4-[(Z)-[(4,5-dimethyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] 2,6-difluorobenzoate |
| SMILES | Cc1nc(N/N=C\c2ccc(OC(=O)c3c(F)cccc3F)cc2)sc1C |
| InChI | InChI=1S/C19H15F2N3O2S/c1-11-12(2)27-19(23-11)24-22-10-13-6-8-14(9-7-13)26-18(25)17-15(20)4-3-5-16(17)21/h3-10H,1-2H3,(H,23,24)/b22-10- |
| InChIKey | HCIITGVYIJRYFE-YVNNLAQVSA-N |
| XLogP | 4.70 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|