C31H29N3O9S — CID 126025677
2-methoxyethyl (2E,5S)-5-(2-ethoxy-3-methoxyphenyl)-7-methyl-2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126025677) has the molecular formula C31H29N3O9S and a molecular weight of 619.65 g/mol. Its IUPAC name is 2-methoxyethyl (2E,5S)-5-(2-ethoxy-3-methoxyphenyl)-7-methyl-2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | 2-methoxyethyl (2E,5S)-5-(2-ethoxy-3-methoxyphenyl)-7-methyl-2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126025677 |
| Molecular Formula | C31H29N3O9S |
| Molecular Weight | 619.65 g/mol |
| Exact Mass | 619.16 |
| IUPAC Name | 2-methoxyethyl (2E,5S)-5-(2-ethoxy-3-methoxyphenyl)-7-methyl-2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOc1c(OC)cccc1[C@H]1C(C(=O)OCCOC)=C(C)N=c2s/c(=C/c3ccc(-c4ccc([N+](=O)[O-])cc4)o3)c(=O)n21 |
| InChI | InChI=1S/C31H29N3O9S/c1-5-41-28-22(7-6-8-24(28)40-4)27-26(30(36)42-16-15-39-3)18(2)32-31-33(27)29(35)25(44-31)17-21-13-14-23(43-21)19-9-11-20(12-10-19)34(37)38/h6-14,17,27H,5,15-16H2,1-4H3/b25-17+/t27-/m0/s1 |
| InChIKey | VRHKYCHWJPHJHT-CSJROMOCSA-N |
| XLogP | 4.00 |
| TPSA | 144.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.65 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|