C22H26Cl2N2O3S — CID 126026477
2-[benzenesulfonyl-[(3,4-dichlorophenyl)methyl]amino]-N-cycloheptylacetamide (PubChem CID 126026477) has the molecular formula C22H26Cl2N2O3S and a molecular weight of 469.43 g/mol. Its IUPAC name is 2-[benzenesulfonyl-[(3,4-dichlorophenyl)methyl]amino]-N-cycloheptylacetamide.
| Compound Name | 2-[benzenesulfonyl-[(3,4-dichlorophenyl)methyl]amino]-N-cycloheptylacetamide |
|---|---|
| PubChem CID | 126026477 |
| Molecular Formula | C22H26Cl2N2O3S |
| Molecular Weight | 469.43 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 2-[benzenesulfonyl-[(3,4-dichlorophenyl)methyl]amino]-N-cycloheptylacetamide |
| SMILES | O=C(CN(Cc1ccc(Cl)c(Cl)c1)S(=O)(=O)c1ccccc1)NC1CCCCCC1 |
| InChI | InChI=1S/C22H26Cl2N2O3S/c23-20-13-12-17(14-21(20)24)15-26(30(28,29)19-10-6-3-7-11-19)16-22(27)25-18-8-4-1-2-5-9-18/h3,6-7,10-14,18H,1-2,4-5,8-9,15-16H2,(H,25,27) |
| InChIKey | KTDGGODZKHXLEK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.43 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |