C21H23IN2O4 — CID 126029057
1-(2,6-dimethoxybenzoyl)-N-(4-iodophenyl)piperidine-4-carboxamide (PubChem CID 126029057) has the molecular formula C21H23IN2O4 and a molecular weight of 494.33 g/mol. Its IUPAC name is 1-(2,6-dimethoxybenzoyl)-N-(4-iodophenyl)piperidine-4-carboxamide.
| Compound Name | 1-(2,6-dimethoxybenzoyl)-N-(4-iodophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126029057 |
| Molecular Formula | C21H23IN2O4 |
| Molecular Weight | 494.33 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | 1-(2,6-dimethoxybenzoyl)-N-(4-iodophenyl)piperidine-4-carboxamide |
| SMILES | COc1cccc(OC)c1C(=O)N1CCC(C(=O)Nc2ccc(I)cc2)CC1 |
| InChI | InChI=1S/C21H23IN2O4/c1-27-17-4-3-5-18(28-2)19(17)21(26)24-12-10-14(11-13-24)20(25)23-16-8-6-15(22)7-9-16/h3-9,14H,10-13H2,1-2H3,(H,23,25) |
| InChIKey | PQELDXYNYUHPLV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|