C22H17ClN2OS2 — CID 126029612
(Z)-3-[5-(4-chlorophenyl)sulfanylthiophen-2-yl]-2-cyano-N-(3,4-dimethylphenyl)prop-2-enamide (PubChem CID 126029612) has the molecular formula C22H17ClN2OS2 and a molecular weight of 424.98 g/mol. Its IUPAC name is (Z)-3-[5-(4-chlorophenyl)sulfanylthiophen-2-yl]-2-cyano-N-(3,4-dimethylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-[5-(4-chlorophenyl)sulfanylthiophen-2-yl]-2-cyano-N-(3,4-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126029612 |
| Molecular Formula | C22H17ClN2OS2 |
| Molecular Weight | 424.98 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | (Z)-3-[5-(4-chlorophenyl)sulfanylthiophen-2-yl]-2-cyano-N-(3,4-dimethylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C(C#N)=C\c2ccc(Sc3ccc(Cl)cc3)s2)cc1C |
| InChI | InChI=1S/C22H17ClN2OS2/c1-14-3-6-18(11-15(14)2)25-22(26)16(13-24)12-20-9-10-21(28-20)27-19-7-4-17(23)5-8-19/h3-12H,1-2H3,(H,25,26)/b16-12- |
| InChIKey | BFMMQFSVFKZKBH-VBKFSLOCSA-N |
| XLogP | 6.72 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.98 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|