C13H11I2NO3S — CID 126029870
(5E)-5-[(2-hydroxy-3,5-diiodophenyl)methylidene]-3-propan-2-yl-1,3-thiazolidine-2,4-dione (PubChem CID 126029870) has the molecular formula C13H11I2NO3S and a molecular weight of 515.11 g/mol. Its IUPAC name is (5E)-5-[(2-hydroxy-3,5-diiodophenyl)methylidene]-3-propan-2-yl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(2-hydroxy-3,5-diiodophenyl)methylidene]-3-propan-2-yl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126029870 |
| Molecular Formula | C13H11I2NO3S |
| Molecular Weight | 515.11 g/mol |
| Exact Mass | 514.85 |
| IUPAC Name | (5E)-5-[(2-hydroxy-3,5-diiodophenyl)methylidene]-3-propan-2-yl-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)N1C(=O)S/C(=C/c2cc(I)cc(I)c2O)C1=O |
| InChI | InChI=1S/C13H11I2NO3S/c1-6(2)16-12(18)10(20-13(16)19)4-7-3-8(14)5-9(15)11(7)17/h3-6,17H,1-2H3/b10-4+ |
| InChIKey | WVYIEQZMZFDAPT-ONNFQVAWSA-N |
| XLogP | 4.05 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.11 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|