C16H18IN3O4S — CID 126215437
(5E)-5-[(2-hydroxy-3-iodo-5-nitrophenyl)methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one (PubChem CID 126215437) has the molecular formula C16H18IN3O4S and a molecular weight of 475.31 g/mol. Its IUPAC name is (5E)-5-[(2-hydroxy-3-iodo-5-nitrophenyl)methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(2-hydroxy-3-iodo-5-nitrophenyl)methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126215437 |
| Molecular Formula | C16H18IN3O4S |
| Molecular Weight | 475.31 g/mol |
| Exact Mass | 475.01 |
| IUPAC Name | (5E)-5-[(2-hydroxy-3-iodo-5-nitrophenyl)methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one |
| SMILES | CC(C)/N=C1\S/C(=C/c2cc([N+](=O)[O-])cc(I)c2O)C(=O)N1C(C)C |
| InChI | InChI=1S/C16H18IN3O4S/c1-8(2)18-16-19(9(3)4)15(22)13(25-16)6-10-5-11(20(23)24)7-12(17)14(10)21/h5-9,21H,1-4H3/b13-6+,18-16- |
| InChIKey | HWXOUQZTABDMNG-JTGLAQNZSA-N |
| XLogP | 3.99 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|