C19H27NOS — CID 126030780
N-[2-(cyclohexen-1-yl)ethyl]-2-[(3,5-dimethylphenyl)methylsulfanyl]acetamide (PubChem CID 126030780) has the molecular formula C19H27NOS and a molecular weight of 317.50 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[(3,5-dimethylphenyl)methylsulfanyl]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(3,5-dimethylphenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 126030780 |
| Molecular Formula | C19H27NOS |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(3,5-dimethylphenyl)methylsulfanyl]acetamide |
| SMILES | Cc1cc(C)cc(CSCC(=O)NCCC2=CCCCC2)c1 |
| InChI | InChI=1S/C19H27NOS/c1-15-10-16(2)12-18(11-15)13-22-14-19(21)20-9-8-17-6-4-3-5-7-17/h6,10-12H,3-5,7-9,13-14H2,1-2H3,(H,20,21) |
| InChIKey | BKHUBZOYYJODEY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|