C14H23NO3S — CID 78760493
ethyl 2-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]sulfanylacetate (PubChem CID 78760493) has the molecular formula C14H23NO3S and a molecular weight of 285.41 g/mol. Its IUPAC name is ethyl 2-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]sulfanylacetate.
| Compound Name | ethyl 2-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]sulfanylacetate |
|---|---|
| PubChem CID | 78760493 |
| Molecular Formula | C14H23NO3S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | ethyl 2-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]sulfanylacetate |
| SMILES | CCOC(=O)CSCC(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C14H23NO3S/c1-2-18-14(17)11-19-10-13(16)15-9-8-12-6-4-3-5-7-12/h6H,2-5,7-11H2,1H3,(H,15,16) |
| InChIKey | WFXZPAZYQUIWAX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|