C18H19Cl2N3O3S — CID 126034906
N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-(4-ethyl-N-methylsulfonylanilino)acetamide (PubChem CID 126034906) has the molecular formula C18H19Cl2N3O3S and a molecular weight of 428.34 g/mol. Its IUPAC name is N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-(4-ethyl-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-(4-ethyl-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126034906 |
| Molecular Formula | C18H19Cl2N3O3S |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-(4-ethyl-N-methylsulfonylanilino)acetamide |
| SMILES | CCc1ccc(N(CC(=O)N/N=C\c2ccc(Cl)cc2Cl)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H19Cl2N3O3S/c1-3-13-4-8-16(9-5-13)23(27(2,25)26)12-18(24)22-21-11-14-6-7-15(19)10-17(14)20/h4-11H,3,12H2,1-2H3,(H,22,24)/b21-11- |
| InChIKey | NJFUBRYMKRHMIV-NHDPSOOVSA-N |
| XLogP | 3.47 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|