C24H18N4O7 — CID 126040858
(1S,2R,6R,7S,8R,10R)-4-[(Z)-[4-(2,4-dinitrophenoxy)phenyl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 126040858) has the molecular formula C24H18N4O7 and a molecular weight of 474.43 g/mol. Its IUPAC name is (1S,2R,6R,7S,8R,10R)-4-[(Z)-[4-(2,4-dinitrophenoxy)phenyl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | (1S,2R,6R,7S,8R,10R)-4-[(Z)-[4-(2,4-dinitrophenoxy)phenyl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 126040858 |
| Molecular Formula | C24H18N4O7 |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | (1S,2R,6R,7S,8R,10R)-4-[(Z)-[4-(2,4-dinitrophenoxy)phenyl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H]3C=C[C@@H]([C@@H]4C[C@@H]34)[C@H]2C(=O)N1/N=C\c1ccc(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H18N4O7/c29-23-21-15-6-7-16(18-10-17(15)18)22(21)24(30)26(23)25-11-12-1-4-14(5-2-12)35-20-8-3-13(27(31)32)9-19(20)28(33)34/h1-9,11,15-18,21-22H,10H2/b25-11-/t15-,16-,17-,18-,21+,22+/m0/s1 |
| InChIKey | NMXUHPLLWXIIKW-GVGLJVCUSA-N |
| XLogP | 3.68 |
| TPSA | 145.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|