C24H20N2O5 — CID 126046553
[2-[(E)-3-[2-(2-hydroxybenzoyl)hydrazinyl]-3-oxoprop-1-enyl]phenyl] 4-methylbenzoate (PubChem CID 126046553) has the molecular formula C24H20N2O5 and a molecular weight of 416.43 g/mol. Its IUPAC name is [2-[(E)-3-[2-(2-hydroxybenzoyl)hydrazinyl]-3-oxoprop-1-enyl]phenyl] 4-methylbenzoate.
| Compound Name | [2-[(E)-3-[2-(2-hydroxybenzoyl)hydrazinyl]-3-oxoprop-1-enyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 126046553 |
| Molecular Formula | C24H20N2O5 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | [2-[(E)-3-[2-(2-hydroxybenzoyl)hydrazinyl]-3-oxoprop-1-enyl]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccccc2/C=C/C(=O)NNC(=O)c2ccccc2O)cc1 |
| InChI | InChI=1S/C24H20N2O5/c1-16-10-12-18(13-11-16)24(30)31-21-9-5-2-6-17(21)14-15-22(28)25-26-23(29)19-7-3-4-8-20(19)27/h2-15,27H,1H3,(H,25,28)(H,26,29)/b15-14+ |
| InChIKey | SNYIPJBKQDLIMF-CCEZHUSRSA-N |
| XLogP | 3.39 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|