C26H24BrN3O6S — CID 126053398
methyl (2E,5R)-2-[(3-bromo-5-nitro-4-propoxyphenyl)methylidene]-7-ethyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126053398) has the molecular formula C26H24BrN3O6S and a molecular weight of 586.46 g/mol. Its IUPAC name is methyl (2E,5R)-2-[(3-bromo-5-nitro-4-propoxyphenyl)methylidene]-7-ethyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | methyl (2E,5R)-2-[(3-bromo-5-nitro-4-propoxyphenyl)methylidene]-7-ethyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126053398 |
| Molecular Formula | C26H24BrN3O6S |
| Molecular Weight | 586.46 g/mol |
| Exact Mass | 585.06 |
| IUPAC Name | methyl (2E,5R)-2-[(3-bromo-5-nitro-4-propoxyphenyl)methylidene]-7-ethyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCCOc1c(Br)cc(/C=c2/sc3n(c2=O)[C@H](c2ccccc2)C(C(=O)OC)=C(CC)N=3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H24BrN3O6S/c1-4-11-36-23-17(27)12-15(13-19(23)30(33)34)14-20-24(31)29-22(16-9-7-6-8-10-16)21(25(32)35-3)18(5-2)28-26(29)37-20/h6-10,12-14,22H,4-5,11H2,1-3H3/b20-14+/t22-/m1/s1 |
| InChIKey | LTMWJLOKESVAJB-VOSMRYOYSA-N |
| XLogP | 4.26 |
| TPSA | 113.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|