C23H18ClN3O5S — CID 126044021
methyl (2Z,5R)-2-[(4-chloro-3-nitrophenyl)methylidene]-7-ethyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126044021) has the molecular formula C23H18ClN3O5S and a molecular weight of 483.93 g/mol. Its IUPAC name is methyl (2Z,5R)-2-[(4-chloro-3-nitrophenyl)methylidene]-7-ethyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | methyl (2Z,5R)-2-[(4-chloro-3-nitrophenyl)methylidene]-7-ethyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126044021 |
| Molecular Formula | C23H18ClN3O5S |
| Molecular Weight | 483.93 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | methyl (2Z,5R)-2-[(4-chloro-3-nitrophenyl)methylidene]-7-ethyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCC1=C(C(=O)OC)[C@@H](c2ccccc2)n2c(s/c(=C\c3ccc(Cl)c([N+](=O)[O-])c3)c2=O)=N1 |
| InChI | InChI=1S/C23H18ClN3O5S/c1-3-16-19(22(29)32-2)20(14-7-5-4-6-8-14)26-21(28)18(33-23(26)25-16)12-13-9-10-15(24)17(11-13)27(30)31/h4-12,20H,3H2,1-2H3/b18-12-/t20-/m1/s1 |
| InChIKey | DFBXHRVJISGXKH-JKALPCAWSA-N |
| XLogP | 3.36 |
| TPSA | 103.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.93 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|