C19H20N2O — CID 12605660
4,4-diethyl-1-oxido-3,5-diphenylpyrazol-1-ium (PubChem CID 12605660) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is 4,4-diethyl-1-oxido-3,5-diphenylpyrazol-1-ium.
| Compound Name | 4,4-diethyl-1-oxido-3,5-diphenylpyrazol-1-ium |
|---|---|
| PubChem CID | 12605660 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 4,4-diethyl-1-oxido-3,5-diphenylpyrazol-1-ium |
| SMILES | CCC1(CC)C(c2ccccc2)=N[N+]([O-])=C1c1ccccc1 |
| InChI | InChI=1S/C19H20N2O/c1-3-19(4-2)17(15-11-7-5-8-12-15)20-21(22)18(19)16-13-9-6-10-14-16/h5-14H,3-4H2,1-2H3 |
| InChIKey | SAKRMUWMMHTCRG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|