C30H24O3 — CID 126059912
(3E)-5-(3,4-dimethylphenyl)-3-[(2-phenylmethoxynaphthalen-1-yl)methylidene]furan-2-one (PubChem CID 126059912) has the molecular formula C30H24O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is (3E)-5-(3,4-dimethylphenyl)-3-[(2-phenylmethoxynaphthalen-1-yl)methylidene]furan-2-one.
| Compound Name | (3E)-5-(3,4-dimethylphenyl)-3-[(2-phenylmethoxynaphthalen-1-yl)methylidene]furan-2-one |
|---|---|
| PubChem CID | 126059912 |
| Molecular Formula | C30H24O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | (3E)-5-(3,4-dimethylphenyl)-3-[(2-phenylmethoxynaphthalen-1-yl)methylidene]furan-2-one |
| SMILES | Cc1ccc(C2=C/C(=C\c3c(OCc4ccccc4)ccc4ccccc34)C(=O)O2)cc1C |
| InChI | InChI=1S/C30H24O3/c1-20-12-13-24(16-21(20)2)29-18-25(30(31)33-29)17-27-26-11-7-6-10-23(26)14-15-28(27)32-19-22-8-4-3-5-9-22/h3-18H,19H2,1-2H3/b25-17+ |
| InChIKey | YXZWWERTGAIAKK-KOEQRZSOSA-N |
| XLogP | 7.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|