C20H18O3 — CID 126060625
(3E)-5-(2,5-dimethylphenyl)-3-[(3-methoxyphenyl)methylidene]furan-2-one (PubChem CID 126060625) has the molecular formula C20H18O3 and a molecular weight of 306.36 g/mol. Its IUPAC name is (3E)-5-(2,5-dimethylphenyl)-3-[(3-methoxyphenyl)methylidene]furan-2-one.
| Compound Name | (3E)-5-(2,5-dimethylphenyl)-3-[(3-methoxyphenyl)methylidene]furan-2-one |
|---|---|
| PubChem CID | 126060625 |
| Molecular Formula | C20H18O3 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (3E)-5-(2,5-dimethylphenyl)-3-[(3-methoxyphenyl)methylidene]furan-2-one |
| SMILES | COc1cccc(/C=C2\C=C(c3cc(C)ccc3C)OC2=O)c1 |
| InChI | InChI=1S/C20H18O3/c1-13-7-8-14(2)18(9-13)19-12-16(20(21)23-19)10-15-5-4-6-17(11-15)22-3/h4-12H,1-3H3/b16-10+ |
| InChIKey | SRCAPTRYVCNQFT-MHWRWJLKSA-N |
| XLogP | 4.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|