C19H15ClO2 — CID 126058718
(3E)-3-[(3-chlorophenyl)methylidene]-5-(2,4-dimethylphenyl)furan-2-one (PubChem CID 126058718) has the molecular formula C19H15ClO2 and a molecular weight of 310.78 g/mol. Its IUPAC name is (3E)-3-[(3-chlorophenyl)methylidene]-5-(2,4-dimethylphenyl)furan-2-one.
| Compound Name | (3E)-3-[(3-chlorophenyl)methylidene]-5-(2,4-dimethylphenyl)furan-2-one |
|---|---|
| PubChem CID | 126058718 |
| Molecular Formula | C19H15ClO2 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | (3E)-3-[(3-chlorophenyl)methylidene]-5-(2,4-dimethylphenyl)furan-2-one |
| SMILES | Cc1ccc(C2=C/C(=C\c3cccc(Cl)c3)C(=O)O2)c(C)c1 |
| InChI | InChI=1S/C19H15ClO2/c1-12-6-7-17(13(2)8-12)18-11-15(19(21)22-18)9-14-4-3-5-16(20)10-14/h3-11H,1-2H3/b15-9+ |
| InChIKey | JHYBWEFPPMDNIB-OQLLNIDSSA-N |
| XLogP | 4.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|