C19H16O3 — CID 126066200
(3E)-5-(2,4-dimethylphenyl)-3-[(4-hydroxyphenyl)methylidene]furan-2-one (PubChem CID 126066200) has the molecular formula C19H16O3 and a molecular weight of 292.33 g/mol. Its IUPAC name is (3E)-5-(2,4-dimethylphenyl)-3-[(4-hydroxyphenyl)methylidene]furan-2-one.
| Compound Name | (3E)-5-(2,4-dimethylphenyl)-3-[(4-hydroxyphenyl)methylidene]furan-2-one |
|---|---|
| PubChem CID | 126066200 |
| Molecular Formula | C19H16O3 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | (3E)-5-(2,4-dimethylphenyl)-3-[(4-hydroxyphenyl)methylidene]furan-2-one |
| SMILES | Cc1ccc(C2=C/C(=C\c3ccc(O)cc3)C(=O)O2)c(C)c1 |
| InChI | InChI=1S/C19H16O3/c1-12-3-8-17(13(2)9-12)18-11-15(19(21)22-18)10-14-4-6-16(20)7-5-14/h3-11,20H,1-2H3/b15-10+ |
| InChIKey | XMRWSGREEHBBTP-XNTDXEJSSA-N |
| XLogP | 3.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|