C19H15NO4 — CID 890303
5-(2,4-dimethylphenyl)-3-[(4-nitrophenyl)methylidene]furan-2-one (PubChem CID 890303) has the molecular formula C19H15NO4 and a molecular weight of 321.33 g/mol. Its IUPAC name is 5-(2,4-dimethylphenyl)-3-[(4-nitrophenyl)methylidene]furan-2-one.
| Compound Name | 5-(2,4-dimethylphenyl)-3-[(4-nitrophenyl)methylidene]furan-2-one |
|---|---|
| PubChem CID | 890303 |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 5-(2,4-dimethylphenyl)-3-[(4-nitrophenyl)methylidene]furan-2-one |
| SMILES | Cc1ccc(C2=CC(=Cc3ccc([N+](=O)[O-])cc3)C(=O)O2)c(C)c1 |
| InChI | InChI=1S/C19H15NO4/c1-12-3-8-17(13(2)9-12)18-11-15(19(21)24-18)10-14-4-6-16(7-5-14)20(22)23/h3-11H,1-2H3 |
| InChIKey | QVLWCMCCIHGXJE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|