C22H15FI2N4OS — CID 126062892
4-[(Z)-[4-[(4-fluorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 126062892) has the molecular formula C22H15FI2N4OS and a molecular weight of 656.26 g/mol. Its IUPAC name is 4-[(Z)-[4-[(4-fluorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-[4-[(4-fluorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 126062892 |
| Molecular Formula | C22H15FI2N4OS |
| Molecular Weight | 656.26 g/mol |
| Exact Mass | 655.90 |
| IUPAC Name | 4-[(Z)-[4-[(4-fluorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | Fc1ccc(COc2c(I)cc(/C=N\n3c(-c4ccccc4)n[nH]c3=S)cc2I)cc1 |
| InChI | InChI=1S/C22H15FI2N4OS/c23-17-8-6-14(7-9-17)13-30-20-18(24)10-15(11-19(20)25)12-26-29-21(27-28-22(29)31)16-4-2-1-3-5-16/h1-12H,13H2,(H,28,31)/b26-12- |
| InChIKey | GVGZVXCPPDIFNH-ZRGSRPPYSA-N |
| XLogP | 6.42 |
| TPSA | 55.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.26 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|