C21H20BrNO3S — CID 126066716
(5Z)-5-[[3-bromo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-propan-2-yl-1,3-thiazolidine-2,4-dione (PubChem CID 126066716) has the molecular formula C21H20BrNO3S and a molecular weight of 446.37 g/mol. Its IUPAC name is (5Z)-5-[[3-bromo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-propan-2-yl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-bromo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-propan-2-yl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126066716 |
| Molecular Formula | C21H20BrNO3S |
| Molecular Weight | 446.37 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | (5Z)-5-[[3-bromo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-propan-2-yl-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(COc2ccc(/C=C3\SC(=O)N(C(C)C)C3=O)cc2Br)cc1 |
| InChI | InChI=1S/C21H20BrNO3S/c1-13(2)23-20(24)19(27-21(23)25)11-16-8-9-18(17(22)10-16)26-12-15-6-4-14(3)5-7-15/h4-11,13H,12H2,1-3H3/b19-11- |
| InChIKey | PVSNXRDZGRSLTJ-ODLFYWEKSA-N |
| XLogP | 5.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.37 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|